About [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate
[(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate (PubChem CID 21442083) has the molecular formula C16H30N4O3S
and a molecular weight of 358.51 g/mol. Its IUPAC name is [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate.
Molecular Properties
| Compound Name | [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate |
| PubChem CID | 21442083 |
| Molecular Formula | C16H30N4O3S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate |
| SMILES | [H]/N=C(\OC/C=C/CCCCC)N(C(=O)NSC(C)C)C(=O)N(C)C |
| InChI | InChI=1S/C16H30N4O3S/c1-6-7-8-9-10-11-12-23-14(17)20(16(22)19(4)5)15(21)18-24-13(2)3/h10-11,13,17H,6-9,12H2,1-5H3,(H,18,21)/b11-10+,17-14- |
| InChIKey | DBJORQXFHSXNOU-UDUOVWRXSA-N |
| XLogP | 3.82 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate?
The IUPAC name of [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate (CID 21442083) is [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate.
What is the SMILES notation for [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate?
The canonical SMILES for [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate is [H]/N=C(\OC/C=C/CCCCC)N(C(=O)NSC(C)C)C(=O)N(C)C.
What is the InChIKey of [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate?
The InChIKey is DBJORQXFHSXNOU-UDUOVWRXSA-N. The full InChI is InChI=1S/C16H30N4O3S/c1-6-7-8-9-10-11-12-23-14(17)20(16(22)19(4)5)15(21)18-24-13(2)3/h10-11,13,17H,6-9,12H2,1-5H3,(H,18,21)/b11-10+,17-14-.
What are the key properties of [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate?
[(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate has a molecular weight of 358.51 g/mol, XLogP of 3.82, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-oct-2-enyl] N-(dimethylcarbamoyl)-N-(propan-2-ylsulfanylcarbamoyl)carbamimidate is sourced from PubChem (CID 21442083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).