C10H18N4O3S — CID 21442286
methyl N-(methylcarbamoyl)-N-(thiazepane-2-carbonyl)carbamimidate (PubChem CID 21442286) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is methyl N-(methylcarbamoyl)-N-(thiazepane-2-carbonyl)carbamimidate.
| Compound Name | methyl N-(methylcarbamoyl)-N-(thiazepane-2-carbonyl)carbamimidate |
|---|---|
| PubChem CID | 21442286 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | methyl N-(methylcarbamoyl)-N-(thiazepane-2-carbonyl)carbamimidate |
| SMILES | [H]/N=C(\OC)N(C(=O)NC)C(=O)N1CCCCCS1 |
| InChI | InChI=1S/C10H18N4O3S/c1-12-9(15)14(8(11)17-2)10(16)13-6-4-3-5-7-18-13/h11H,3-7H2,1-2H3,(H,12,15)/b11-8- |
| InChIKey | PXKDEQRRIYOTGD-FLIBITNWSA-N |
| XLogP | 1.46 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|