C8H17N3S — CID 54259853
1,3-dimethyl-1-piperidin-1-ylthiourea (PubChem CID 54259853) has the molecular formula C8H17N3S and a molecular weight of 187.31 g/mol. Its IUPAC name is 1,3-dimethyl-1-piperidin-1-ylthiourea.
| Compound Name | 1,3-dimethyl-1-piperidin-1-ylthiourea |
|---|---|
| PubChem CID | 54259853 |
| Molecular Formula | C8H17N3S |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1,3-dimethyl-1-piperidin-1-ylthiourea |
| SMILES | CNC(=S)N(C)N1CCCCC1 |
| InChI | InChI=1S/C8H17N3S/c1-9-8(12)10(2)11-6-4-3-5-7-11/h3-7H2,1-2H3,(H,9,12) |
| InChIKey | RCSREFKWIKEEJE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|