C18H26Cl2N4O3S — CID 21442054
methyl N-(dibutylcarbamoyl)-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate (PubChem CID 21442054) has the molecular formula C18H26Cl2N4O3S and a molecular weight of 449.40 g/mol. Its IUPAC name is methyl N-(dibutylcarbamoyl)-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate.
| Compound Name | methyl N-(dibutylcarbamoyl)-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate |
|---|---|
| PubChem CID | 21442054 |
| Molecular Formula | C18H26Cl2N4O3S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | methyl N-(dibutylcarbamoyl)-N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]carbamimidate |
| SMILES | [H]/N=C(\OC)N(C(=O)NSc1ccc(Cl)c(Cl)c1)C(=O)N(CCCC)CCCC |
| InChI | InChI=1S/C18H26Cl2N4O3S/c1-4-6-10-23(11-7-5-2)18(26)24(16(21)27-3)17(25)22-28-13-8-9-14(19)15(20)12-13/h8-9,12,21H,4-7,10-11H2,1-3H3,(H,22,25)/b21-16- |
| InChIKey | IVCOYISNLIUNOT-PGMHBOJBSA-N |
| XLogP | 5.62 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|