C12H14Cl2N4O3S — CID 21442377
methyl N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-N-(ethylcarbamoyl)carbamimidate (PubChem CID 21442377) has the molecular formula C12H14Cl2N4O3S and a molecular weight of 365.24 g/mol. Its IUPAC name is methyl N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-N-(ethylcarbamoyl)carbamimidate.
| Compound Name | methyl N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-N-(ethylcarbamoyl)carbamimidate |
|---|---|
| PubChem CID | 21442377 |
| Molecular Formula | C12H14Cl2N4O3S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | methyl N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-N-(ethylcarbamoyl)carbamimidate |
| SMILES | [H]/N=C(\OC)N(C(=O)NCC)C(=O)NSc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N4O3S/c1-3-16-11(19)18(10(15)21-2)12(20)17-22-7-4-5-8(13)9(14)6-7/h4-6,15H,3H2,1-2H3,(H,16,19)(H,17,20)/b15-10- |
| InChIKey | YTLWKJJHJZAUHK-GDNBJRDFSA-N |
| XLogP | 3.32 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|