C16H10BrCl2N3O2S — CID 135358697
methyl (E)-2-azido-3-[3-bromo-4-(3,4-dichlorophenyl)sulfanylphenyl]prop-2-enoate (PubChem CID 135358697) has the molecular formula C16H10BrCl2N3O2S and a molecular weight of 459.15 g/mol. Its IUPAC name is methyl (E)-2-azido-3-[3-bromo-4-(3,4-dichlorophenyl)sulfanylphenyl]prop-2-enoate.
| Compound Name | methyl (E)-2-azido-3-[3-bromo-4-(3,4-dichlorophenyl)sulfanylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 135358697 |
| Molecular Formula | C16H10BrCl2N3O2S |
| Molecular Weight | 459.15 g/mol |
| Exact Mass | 456.91 |
| IUPAC Name | methyl (E)-2-azido-3-[3-bromo-4-(3,4-dichlorophenyl)sulfanylphenyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C\c1ccc(Sc2ccc(Cl)c(Cl)c2)c(Br)c1)N=[N+]=[N-] |
| InChI | InChI=1S/C16H10BrCl2N3O2S/c1-24-16(23)14(21-22-20)7-9-2-5-15(11(17)6-9)25-10-3-4-12(18)13(19)8-10/h2-8H,1H3/b14-7+ |
| InChIKey | LFHIYXWDZHXFIH-VGOFMYFVSA-N |
| XLogP | 6.73 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.15 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|