C22H15Cl2N3O2S — CID 142453982
methyl (Z)-3-[2-azido-4-(3,4-dichlorophenyl)sulfanyl-3-phenylphenyl]prop-2-enoate (PubChem CID 142453982) has the molecular formula C22H15Cl2N3O2S and a molecular weight of 456.35 g/mol. Its IUPAC name is methyl (Z)-3-[2-azido-4-(3,4-dichlorophenyl)sulfanyl-3-phenylphenyl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[2-azido-4-(3,4-dichlorophenyl)sulfanyl-3-phenylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 142453982 |
| Molecular Formula | C22H15Cl2N3O2S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | methyl (Z)-3-[2-azido-4-(3,4-dichlorophenyl)sulfanyl-3-phenylphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C\c1ccc(Sc2ccc(Cl)c(Cl)c2)c(-c2ccccc2)c1N=[N+]=[N-] |
| InChI | InChI=1S/C22H15Cl2N3O2S/c1-29-20(28)12-8-15-7-11-19(30-16-9-10-17(23)18(24)13-16)21(22(15)26-27-25)14-5-3-2-4-6-14/h2-13H,1H3/b12-8- |
| InChIKey | FWHABCRCSRNUQM-WQLSENKSSA-N |
| XLogP | 7.94 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|