C13H9Cl2NO2S — CID 114075144
methyl 2-(3,4-dichlorophenyl)sulfanylpyridine-4-carboxylate (PubChem CID 114075144) has the molecular formula C13H9Cl2NO2S and a molecular weight of 314.19 g/mol. Its IUPAC name is methyl 2-(3,4-dichlorophenyl)sulfanylpyridine-4-carboxylate.
| Compound Name | methyl 2-(3,4-dichlorophenyl)sulfanylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 114075144 |
| Molecular Formula | C13H9Cl2NO2S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | methyl 2-(3,4-dichlorophenyl)sulfanylpyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(Sc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H9Cl2NO2S/c1-18-13(17)8-4-5-16-12(6-8)19-9-2-3-10(14)11(15)7-9/h2-7H,1H3 |
| InChIKey | OOAHPFQBRVDUTP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |