C15H9Cl3N2O2S — CID 135358046
methyl 4-chloro-6-(3,4-dichlorophenyl)sulfanyl-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (PubChem CID 135358046) has the molecular formula C15H9Cl3N2O2S and a molecular weight of 387.68 g/mol. Its IUPAC name is methyl 4-chloro-6-(3,4-dichlorophenyl)sulfanyl-1H-pyrrolo[3,2-c]pyridine-2-carboxylate.
| Compound Name | methyl 4-chloro-6-(3,4-dichlorophenyl)sulfanyl-1H-pyrrolo[3,2-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 135358046 |
| Molecular Formula | C15H9Cl3N2O2S |
| Molecular Weight | 387.68 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | methyl 4-chloro-6-(3,4-dichlorophenyl)sulfanyl-1H-pyrrolo[3,2-c]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc2c(Cl)nc(Sc3ccc(Cl)c(Cl)c3)cc2[nH]1 |
| InChI | InChI=1S/C15H9Cl3N2O2S/c1-22-15(21)12-5-8-11(19-12)6-13(20-14(8)18)23-7-2-3-9(16)10(17)4-7/h2-6,19H,1H3 |
| InChIKey | QNMPCTKLYOTMRV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|