C17H13Cl2NO2S — CID 71625515
3-(3,4-dichlorophenyl)sulfanyl-6-ethyl-1H-indole-2-carboxylic acid (PubChem CID 71625515) has the molecular formula C17H13Cl2NO2S and a molecular weight of 366.27 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)sulfanyl-6-ethyl-1H-indole-2-carboxylic acid.
| Compound Name | 3-(3,4-dichlorophenyl)sulfanyl-6-ethyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 71625515 |
| Molecular Formula | C17H13Cl2NO2S |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 3-(3,4-dichlorophenyl)sulfanyl-6-ethyl-1H-indole-2-carboxylic acid |
| SMILES | CCc1ccc2c(Sc3ccc(Cl)c(Cl)c3)c(C(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C17H13Cl2NO2S/c1-2-9-3-5-11-14(7-9)20-15(17(21)22)16(11)23-10-4-6-12(18)13(19)8-10/h3-8,20H,2H2,1H3,(H,21,22) |
| InChIKey | GFEHQTBISQVZNP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |