C28H27ClN2OS — CID 22513721
(4-benzylpiperidin-1-yl)-[3-(4-chlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]methanone (PubChem CID 22513721) has the molecular formula C28H27ClN2OS and a molecular weight of 475.06 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[3-(4-chlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[3-(4-chlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 22513721 |
| Molecular Formula | C28H27ClN2OS |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[3-(4-chlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]methanone |
| SMILES | Cc1ccc2c(Sc3ccc(Cl)cc3)c(C(=O)N3CCC(Cc4ccccc4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C28H27ClN2OS/c1-19-7-12-24-25(17-19)30-26(27(24)33-23-10-8-22(29)9-11-23)28(32)31-15-13-21(14-16-31)18-20-5-3-2-4-6-20/h2-12,17,21,30H,13-16,18H2,1H3 |
| InChIKey | NCIQITXHKHIGII-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |