C17H25Cl2N4O3S+ — CID 21442089
(C-butoxycarbonimidoyl)-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-(dimethylcarbamoyl)-ethylazanium (PubChem CID 21442089) has the molecular formula C17H25Cl2N4O3S+ and a molecular weight of 436.39 g/mol. Its IUPAC name is (C-butoxycarbonimidoyl)-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-(dimethylcarbamoyl)-ethylazanium.
| Compound Name | (C-butoxycarbonimidoyl)-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-(dimethylcarbamoyl)-ethylazanium |
|---|---|
| PubChem CID | 21442089 |
| Molecular Formula | C17H25Cl2N4O3S+ |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (C-butoxycarbonimidoyl)-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-(dimethylcarbamoyl)-ethylazanium |
| SMILES | [H]/N=C(\OCCCC)[N+](CC)(C(=O)NSc1ccc(Cl)c(Cl)c1)C(=O)N(C)C |
| InChI | InChI=1S/C17H24Cl2N4O3S/c1-5-7-10-26-15(20)23(6-2,17(25)22(3)4)16(24)21-27-12-8-9-13(18)14(19)11-12/h8-9,11,20H,5-7,10H2,1-4H3/p+1/b20-15- |
| InChIKey | COAMIZPLNSZKAB-HKWRFOASSA-O |
| XLogP | 4.98 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|