C18H26Cl2N4O3S — CID 173453217
butan-2-yl N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate (PubChem CID 173453217) has the molecular formula C18H26Cl2N4O3S and a molecular weight of 449.40 g/mol. Its IUPAC name is butan-2-yl N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate.
| Compound Name | butan-2-yl N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate |
|---|---|
| PubChem CID | 173453217 |
| Molecular Formula | C18H26Cl2N4O3S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | butan-2-yl N-[(3,4-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate |
| SMILES | CCC(C)OC(=NC(=O)N(C)C)N(C(=O)NSc1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C18H26Cl2N4O3S/c1-7-12(4)27-18(21-16(25)23(5)6)24(11(2)3)17(26)22-28-13-8-9-14(19)15(20)10-13/h8-12H,7H2,1-6H3,(H,22,26) |
| InChIKey | FSFDYEOMHVLXGZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|