C13H20N2O — CID 6469320
1-tert-butyl-3-(3,5-dimethylphenyl)urea (PubChem CID 6469320) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-tert-butyl-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 6469320 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-tert-butyl-3-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C13H20N2O/c1-9-6-10(2)8-11(7-9)14-12(16)15-13(3,4)5/h6-8H,1-5H3,(H2,14,15,16) |
| InChIKey | GXEITSGTMZVOAB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |