C8H18N4O — CID 141477803
(N,N-dipropylcarbamimidoyl)urea (PubChem CID 141477803) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is (N,N-dipropylcarbamimidoyl)urea.
| Compound Name | (N,N-dipropylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 141477803 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | (N,N-dipropylcarbamimidoyl)urea |
| SMILES | [H]/N=C(\NC(N)=O)N(CCC)CCC |
| InChI | InChI=1S/C8H18N4O/c1-3-5-12(6-4-2)7(9)11-8(10)13/h3-6H2,1-2H3,(H4,9,10,11,13) |
| InChIKey | UULZOXAYWSURQW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|