C10H22N2O — CID 60836307
3-amino-N,N-dipropylbutanamide (PubChem CID 60836307) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-amino-N,N-dipropylbutanamide.
| Compound Name | 3-amino-N,N-dipropylbutanamide |
|---|---|
| PubChem CID | 60836307 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 3-amino-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)CC(C)N |
| InChI | InChI=1S/C10H22N2O/c1-4-6-12(7-5-2)10(13)8-9(3)11/h9H,4-8,11H2,1-3H3 |
| InChIKey | FGXHYFPNFIHBEX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |