About N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride
N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride (PubChem CID 53347078) has the molecular formula C10H16ClN4O2S-
and a molecular weight of 291.78 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride.
Molecular Properties
| Compound Name | N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride |
| PubChem CID | 53347078 |
| Molecular Formula | C10H16ClN4O2S- |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride |
| SMILES | [Cl-].[H]/N=c1\sccn1CC(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C10H16N4O2S.ClH/c1-10(2,3)13-9(16)12-7(15)6-14-4-5-17-8(14)11;/h4-5,11H,6H2,1-3H3,(H2,12,13,15,16);1H/p-1/b11-8-; |
| InChIKey | NXQMOLPXZMNLRD-MKFZHGHUSA-M |
| XLogP | -2.34 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride?
The IUPAC name of N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride (CID 53347078) is N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride.
What is the SMILES notation for N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride?
The canonical SMILES for N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride is [Cl-].[H]/N=c1\sccn1CC(=O)NC(=O)NC(C)(C)C.
What is the InChIKey of N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride?
The InChIKey is NXQMOLPXZMNLRD-MKFZHGHUSA-M. The full InChI is InChI=1S/C10H16N4O2S.ClH/c1-10(2,3)13-9(16)12-7(15)6-14-4-5-17-8(14)11;/h4-5,11H,6H2,1-3H3,(H2,12,13,15,16);1H/p-1/b11-8-;.
What are the key properties of N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride?
N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride has a molecular weight of 291.78 g/mol, XLogP of -2.34, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(tert-butylcarbamoyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride is sourced from PubChem (CID 53347078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).