C13H14ClN4O3S- — CID 53350739
N-(4,5-dimethyl-2-nitrophenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride (PubChem CID 53350739) has the molecular formula C13H14ClN4O3S- and a molecular weight of 341.80 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-nitrophenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride.
| Compound Name | N-(4,5-dimethyl-2-nitrophenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride |
|---|---|
| PubChem CID | 53350739 |
| Molecular Formula | C13H14ClN4O3S- |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | N-(4,5-dimethyl-2-nitrophenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride |
| SMILES | [Cl-].[H]/N=c1\sccn1CC(=O)Nc1cc(C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N4O3S.ClH/c1-8-5-10(11(17(19)20)6-9(8)2)15-12(18)7-16-3-4-21-13(16)14;/h3-6,14H,7H2,1-2H3,(H,15,18);1H/p-1/b14-13-; |
| InChIKey | FIKYCKPHAROKRJ-HPWRNOGASA-M |
| XLogP | -0.80 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|