C18H17ClN3OS- — CID 53314557
N-(2-benzylphenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride (PubChem CID 53314557) has the molecular formula C18H17ClN3OS- and a molecular weight of 358.87 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride.
| Compound Name | N-(2-benzylphenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride |
|---|---|
| PubChem CID | 53314557 |
| Molecular Formula | C18H17ClN3OS- |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-(2-benzylphenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide chloride |
| SMILES | [Cl-].[H]/N=c1\sccn1CC(=O)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C18H17N3OS.ClH/c19-18-21(10-11-23-18)13-17(22)20-16-9-5-4-8-15(16)12-14-6-2-1-3-7-14;/h1-11,19H,12-13H2,(H,20,22);1H/p-1/b19-18-; |
| InChIKey | JRXBYNKHAMMAJU-TVWXOORISA-M |
| XLogP | 0.26 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |