C21H24ClN3OS — CID 11834405
2-(2-imino-1,3-thiazol-3-yl)-N,N-bis(2-phenylethyl)acetamide;hydrochloride (PubChem CID 11834405) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is 2-(2-imino-1,3-thiazol-3-yl)-N,N-bis(2-phenylethyl)acetamide;hydrochloride.
| Compound Name | 2-(2-imino-1,3-thiazol-3-yl)-N,N-bis(2-phenylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 11834405 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(2-imino-1,3-thiazol-3-yl)-N,N-bis(2-phenylethyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=c1\sccn1CC(=O)N(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C21H23N3OS.ClH/c22-21-24(15-16-26-21)17-20(25)23(13-11-18-7-3-1-4-8-18)14-12-19-9-5-2-6-10-19;/h1-10,15-16,22H,11-14,17H2;1H/b22-21-; |
| InChIKey | WCGYVUMBNSPMPG-SVXKRPBISA-N |
| XLogP | 3.76 |
| TPSA | 49.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |