C22H23N3O4 — CID 2536296
2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)-N,N-bis(2-phenylethyl)acetamide (PubChem CID 2536296) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)-N,N-bis(2-phenylethyl)acetamide.
| Compound Name | 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)-N,N-bis(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 2536296 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)-N,N-bis(2-phenylethyl)acetamide |
| SMILES | CN1C(=O)C(=O)N(CC(=O)N(CCc2ccccc2)CCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H23N3O4/c1-23-20(27)21(28)25(22(23)29)16-19(26)24(14-12-17-8-4-2-5-9-17)15-13-18-10-6-3-7-11-18/h2-11H,12-16H2,1H3 |
| InChIKey | KTDCCCZIQSYNBS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|