C21H29N3O3 — CID 55587303
N-ethyl-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-phenylethyl)acetamide (PubChem CID 55587303) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-ethyl-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-phenylethyl)acetamide.
| Compound Name | N-ethyl-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 55587303 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-ethyl-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-phenylethyl)acetamide |
| SMILES | CCN(CCc1ccccc1)C(=O)CN1C(=O)N(C)C2(CCCCC2)C1=O |
| InChI | InChI=1S/C21H29N3O3/c1-3-23(15-12-17-10-6-4-7-11-17)18(25)16-24-19(26)21(22(2)20(24)27)13-8-5-9-14-21/h4,6-7,10-11H,3,5,8-9,12-16H2,1-2H3 |
| InChIKey | IUPXBVLEFDSZNR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|