C13H14ClN3OS — CID 2567185
N-[2-(4-chlorophenyl)ethyl]-2-(2-imino-1,3-thiazol-3-yl)acetamide (PubChem CID 2567185) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-(2-imino-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-(2-imino-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 2567185 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-(2-imino-1,3-thiazol-3-yl)acetamide |
| SMILES | [H]/N=c1\sccn1CC(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClN3OS/c14-11-3-1-10(2-4-11)5-6-16-12(18)9-17-7-8-19-13(17)15/h1-4,7-8,15H,5-6,9H2,(H,16,18)/b15-13- |
| InChIKey | YIBLGCSKRYNCRR-SQFISAMPSA-N |
| XLogP | 2.04 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |