C21H17F3N2O2 — CID 2623886
N-(2-benzylphenyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 2623886) has the molecular formula C21H17F3N2O2 and a molecular weight of 386.37 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-(2-benzylphenyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 2623886 |
| Molecular Formula | C21H17F3N2O2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-(2-benzylphenyl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C21H17F3N2O2/c22-21(23,24)17-10-11-20(28)26(13-17)14-19(27)25-18-9-5-4-8-16(18)12-15-6-2-1-3-7-15/h1-11,13H,12,14H2,(H,25,27) |
| InChIKey | WAMWAFDYLQJQJC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |