C22H12ClF3N2O4 — CID 38846285
N-(3-chloro-9,10-dioxoanthracen-2-yl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 38846285) has the molecular formula C22H12ClF3N2O4 and a molecular weight of 460.80 g/mol. Its IUPAC name is N-(3-chloro-9,10-dioxoanthracen-2-yl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-(3-chloro-9,10-dioxoanthracen-2-yl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 38846285 |
| Molecular Formula | C22H12ClF3N2O4 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | N-(3-chloro-9,10-dioxoanthracen-2-yl)-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)Nc1cc2c(cc1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H12ClF3N2O4/c23-16-7-14-15(21(32)13-4-2-1-3-12(13)20(14)31)8-17(16)27-18(29)10-28-9-11(22(24,25)26)5-6-19(28)30/h1-9H,10H2,(H,27,29) |
| InChIKey | CZKGOQBSUQBEDF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|