C14H9ClF3IN2O2 — CID 16574639
2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(2-iodophenyl)acetamide (PubChem CID 16574639) has the molecular formula C14H9ClF3IN2O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 16574639 |
| Molecular Formula | C14H9ClF3IN2O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 455.93 |
| IUPAC Name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(2-iodophenyl)acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)cc(Cl)c1=O)Nc1ccccc1I |
| InChI | InChI=1S/C14H9ClF3IN2O2/c15-9-5-8(14(16,17)18)6-21(13(9)23)7-12(22)20-11-4-2-1-3-10(11)19/h1-6H,7H2,(H,20,22) |
| InChIKey | ZUNUDULBCADDMK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|