C14H8BrCl2F3N2O2 — CID 24566337
N-(4-bromo-2-chlorophenyl)-2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 24566337) has the molecular formula C14H8BrCl2F3N2O2 and a molecular weight of 444.03 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 24566337 |
| Molecular Formula | C14H8BrCl2F3N2O2 |
| Molecular Weight | 444.03 g/mol |
| Exact Mass | 441.91 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)cc(Cl)c1=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H8BrCl2F3N2O2/c15-8-1-2-11(9(16)4-8)21-12(23)6-22-5-7(14(18,19)20)3-10(17)13(22)24/h1-5H,6H2,(H,21,23) |
| InChIKey | REGKRJOMPVOGKW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.03 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |