C15H11F3N2O4 — CID 71700189
6-oxo-1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxylic acid (PubChem CID 71700189) has the molecular formula C15H11F3N2O4 and a molecular weight of 340.26 g/mol. Its IUPAC name is 6-oxo-1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxylic acid.
| Compound Name | 6-oxo-1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 71700189 |
| Molecular Formula | C15H11F3N2O4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 6-oxo-1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxylic acid |
| SMILES | O=C(Cn1cc(C(=O)O)ccc1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H11F3N2O4/c16-15(17,18)10-3-1-2-4-11(10)19-12(21)8-20-7-9(14(23)24)5-6-13(20)22/h1-7H,8H2,(H,19,21)(H,23,24) |
| InChIKey | WPWWANAGRKPBDZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |