C12H10F3N3O2S — CID 5168236
2-(2-imino-1,3-thiazol-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 5168236) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-(2-imino-1,3-thiazol-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(2-imino-1,3-thiazol-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 5168236 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-(2-imino-1,3-thiazol-3-yl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | [H]/N=c1\sccn1CC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3N3O2S/c13-12(14,15)20-9-3-1-8(2-4-9)17-10(19)7-18-5-6-21-11(18)16/h1-6,16H,7H2,(H,17,19)/b16-11- |
| InChIKey | XMXIKVBNNSMEKN-WJDWOHSUSA-N |
| XLogP | 2.57 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |