C14H20F6O2 — CID 147286139
(Z)-9,9,9-trifluoro-6-hydroxy-3,3,7-trimethyl-7-(2,2,2-trifluoroethyl)non-5-en-4-one (PubChem CID 147286139) has the molecular formula C14H20F6O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is (Z)-9,9,9-trifluoro-6-hydroxy-3,3,7-trimethyl-7-(2,2,2-trifluoroethyl)non-5-en-4-one.
| Compound Name | (Z)-9,9,9-trifluoro-6-hydroxy-3,3,7-trimethyl-7-(2,2,2-trifluoroethyl)non-5-en-4-one |
|---|---|
| PubChem CID | 147286139 |
| Molecular Formula | C14H20F6O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (Z)-9,9,9-trifluoro-6-hydroxy-3,3,7-trimethyl-7-(2,2,2-trifluoroethyl)non-5-en-4-one |
| SMILES | CCC(C)(C)C(=O)/C=C(\O)C(C)(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C14H20F6O2/c1-5-11(2,3)9(21)6-10(22)12(4,7-13(15,16)17)8-14(18,19)20/h6,22H,5,7-8H2,1-4H3/b10-6- |
| InChIKey | CTGRWIYJLDVJSU-POHAHGRESA-N |
| XLogP | 5.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|