About bis(2-chloroethyl) (E)-2-methylbut-2-enedioate
bis(2-chloroethyl) (E)-2-methylbut-2-enedioate (PubChem CID 87337015) has the molecular formula C9H12Cl2O4
and a molecular weight of 255.10 g/mol. Its IUPAC name is bis(2-chloroethyl) (E)-2-methylbut-2-enedioate.
Molecular Properties
| Compound Name | bis(2-chloroethyl) (E)-2-methylbut-2-enedioate |
| PubChem CID | 87337015 |
| Molecular Formula | C9H12Cl2O4 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | bis(2-chloroethyl) (E)-2-methylbut-2-enedioate |
| SMILES | C/C(=C\C(=O)OCCCl)C(=O)OCCCl |
| InChI | InChI=1S/C9H12Cl2O4/c1-7(9(13)15-5-3-11)6-8(12)14-4-2-10/h6H,2-5H2,1H3/b7-6+ |
| InChIKey | IXQJKUSFQBMWSW-VOTSOKGWSA-N |
| XLogP | 1.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-chloroethyl) (E)-2-methylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-chloroethyl) (E)-2-methylbut-2-enedioate?
The IUPAC name of bis(2-chloroethyl) (E)-2-methylbut-2-enedioate (CID 87337015) is bis(2-chloroethyl) (E)-2-methylbut-2-enedioate.
What is the SMILES notation for bis(2-chloroethyl) (E)-2-methylbut-2-enedioate?
The canonical SMILES for bis(2-chloroethyl) (E)-2-methylbut-2-enedioate is C/C(=C\C(=O)OCCCl)C(=O)OCCCl.
What is the InChIKey of bis(2-chloroethyl) (E)-2-methylbut-2-enedioate?
The InChIKey is IXQJKUSFQBMWSW-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H12Cl2O4/c1-7(9(13)15-5-3-11)6-8(12)14-4-2-10/h6H,2-5H2,1H3/b7-6+.
What are the key properties of bis(2-chloroethyl) (E)-2-methylbut-2-enedioate?
bis(2-chloroethyl) (E)-2-methylbut-2-enedioate has a molecular weight of 255.10 g/mol, XLogP of 1.50, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-chloroethyl) (E)-2-methylbut-2-enedioate is sourced from PubChem (CID 87337015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).