C21H26F8O4 — CID 91741690
5-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91741690) has the molecular formula C21H26F8O4 and a molecular weight of 494.42 g/mol. Its IUPAC name is 5-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 5-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91741690 |
| Molecular Formula | C21H26F8O4 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 5-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | C=C(C)C#CC(OC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)C(C)CCC |
| InChI | InChI=1S/C21H26F8O4/c1-5-7-14(4)15(11-10-13(2)3)33-17(31)9-6-8-16(30)32-12-19(24,25)21(28,29)20(26,27)18(22)23/h14-15,18H,2,5-9,12H2,1,3-4H3 |
| InChIKey | ZIVDKJOSFYMTSI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|