C22H36O4 — CID 91713544
6-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-pentyl hexanedioate (PubChem CID 91713544) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 6-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-pentyl hexanedioate.
| Compound Name | 6-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-pentyl hexanedioate |
|---|---|
| PubChem CID | 91713544 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 6-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-pentyl hexanedioate |
| SMILES | C=C(C)C#CC(OC(=O)CCCCC(=O)OCCCCC)C(C)CCC |
| InChI | InChI=1S/C22H36O4/c1-6-8-11-17-25-21(23)13-9-10-14-22(24)26-20(16-15-18(3)4)19(5)12-7-2/h19-20H,3,6-14,17H2,1-2,4-5H3 |
| InChIKey | JOESREFGQMOUFF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|