C16H26O2 — CID 531140
2,6-dimethylnon-1-en-3-yn-5-yl 2,2-dimethylpropanoate (PubChem CID 531140) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2,6-dimethylnon-1-en-3-yn-5-yl 2,2-dimethylpropanoate.
| Compound Name | 2,6-dimethylnon-1-en-3-yn-5-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 531140 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2,6-dimethylnon-1-en-3-yn-5-yl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C#CC(OC(=O)C(C)(C)C)C(C)CCC |
| InChI | InChI=1S/C16H26O2/c1-8-9-13(4)14(11-10-12(2)3)18-15(17)16(5,6)7/h13-14H,2,8-9H2,1,3-7H3 |
| InChIKey | DDZBSMWOQSKQFI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|