C13H17Cl3O2 — CID 531065
2,6-dimethylnon-1-en-3-yn-5-yl 2,2,2-trichloroacetate (PubChem CID 531065) has the molecular formula C13H17Cl3O2 and a molecular weight of 311.64 g/mol. Its IUPAC name is 2,6-dimethylnon-1-en-3-yn-5-yl 2,2,2-trichloroacetate.
| Compound Name | 2,6-dimethylnon-1-en-3-yn-5-yl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 531065 |
| Molecular Formula | C13H17Cl3O2 |
| Molecular Weight | 311.64 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 2,6-dimethylnon-1-en-3-yn-5-yl 2,2,2-trichloroacetate |
| SMILES | C=C(C)C#CC(OC(=O)C(Cl)(Cl)Cl)C(C)CCC |
| InChI | InChI=1S/C13H17Cl3O2/c1-5-6-10(4)11(8-7-9(2)3)18-12(17)13(14,15)16/h10-11H,2,5-6H2,1,3-4H3 |
| InChIKey | QUQXVSNIXBWVAX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|