C19H21F3O2 — CID 531210
2,6-dimethylnon-1-en-3-yn-5-yl 2-(trifluoromethyl)benzoate (PubChem CID 531210) has the molecular formula C19H21F3O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2,6-dimethylnon-1-en-3-yn-5-yl 2-(trifluoromethyl)benzoate.
| Compound Name | 2,6-dimethylnon-1-en-3-yn-5-yl 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 531210 |
| Molecular Formula | C19H21F3O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2,6-dimethylnon-1-en-3-yn-5-yl 2-(trifluoromethyl)benzoate |
| SMILES | C=C(C)C#CC(OC(=O)c1ccccc1C(F)(F)F)C(C)CCC |
| InChI | InChI=1S/C19H21F3O2/c1-5-8-14(4)17(12-11-13(2)3)24-18(23)15-9-6-7-10-16(15)19(20,21)22/h6-7,9-10,14,17H,2,5,8H2,1,3-4H3 |
| InChIKey | RSQXEBKVKNSXNK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|