About 1-cyanoethenyl 2-(trifluoromethyl)benzoate
1-cyanoethenyl 2-(trifluoromethyl)benzoate (PubChem CID 154449158) has the molecular formula C11H6F3NO2
and a molecular weight of 241.17 g/mol. Its IUPAC name is 1-cyanoethenyl 2-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | 1-cyanoethenyl 2-(trifluoromethyl)benzoate |
| PubChem CID | 154449158 |
| Molecular Formula | C11H6F3NO2 |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-cyanoethenyl 2-(trifluoromethyl)benzoate |
| SMILES | C=C(C#N)OC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H6F3NO2/c1-7(6-15)17-10(16)8-4-2-3-5-9(8)11(12,13)14/h2-5H,1H2 |
| InChIKey | JRYVRCDKBHZWQD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoethenyl 2-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethenyl 2-(trifluoromethyl)benzoate?
The IUPAC name of 1-cyanoethenyl 2-(trifluoromethyl)benzoate (CID 154449158) is 1-cyanoethenyl 2-(trifluoromethyl)benzoate.
What is the SMILES notation for 1-cyanoethenyl 2-(trifluoromethyl)benzoate?
The canonical SMILES for 1-cyanoethenyl 2-(trifluoromethyl)benzoate is C=C(C#N)OC(=O)c1ccccc1C(F)(F)F.
What is the InChIKey of 1-cyanoethenyl 2-(trifluoromethyl)benzoate?
The InChIKey is JRYVRCDKBHZWQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F3NO2/c1-7(6-15)17-10(16)8-4-2-3-5-9(8)11(12,13)14/h2-5H,1H2.
What are the key properties of 1-cyanoethenyl 2-(trifluoromethyl)benzoate?
1-cyanoethenyl 2-(trifluoromethyl)benzoate has a molecular weight of 241.17 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethenyl 2-(trifluoromethyl)benzoate is sourced from PubChem (CID 154449158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).