About [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate
[2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate (PubChem CID 139973492) has the molecular formula C20H16F3NO2S
and a molecular weight of 391.41 g/mol. Its IUPAC name is [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate.
Molecular Properties
| Compound Name | [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate |
| PubChem CID | 139973492 |
| Molecular Formula | C20H16F3NO2S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate |
| SMILES | CCc1ccc(C(C#N)=C(OC(=O)SC)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3NO2S/c1-3-13-8-10-14(11-9-13)16(12-24)18(26-19(25)27-2)15-6-4-5-7-17(15)20(21,22)23/h4-11H,3H2,1-2H3 |
| InChIKey | ZTJGJHVMXNOXRO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate?
The IUPAC name of [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate (CID 139973492) is [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate.
What is the SMILES notation for [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate?
The canonical SMILES for [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate is CCc1ccc(C(C#N)=C(OC(=O)SC)c2ccccc2C(F)(F)F)cc1.
What is the InChIKey of [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate?
The InChIKey is ZTJGJHVMXNOXRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F3NO2S/c1-3-13-8-10-14(11-9-13)16(12-24)18(26-19(25)27-2)15-6-4-5-7-17(15)20(21,22)23/h4-11H,3H2,1-2H3.
What are the key properties of [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate?
[2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate has a molecular weight of 391.41 g/mol, XLogP of 6.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-2-(4-ethylphenyl)-1-[2-(trifluoromethyl)phenyl]ethenyl] methylsulfanylformate is sourced from PubChem (CID 139973492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).