C23H23F3N2O — CID 59073065
N-[(Z)-1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 59073065) has the molecular formula C23H23F3N2O and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[(Z)-1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(Z)-1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 59073065 |
| Molecular Formula | C23H23F3N2O |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[(Z)-1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C)cc(/C(C#N)=C(/NC(=O)c2ccccc2C(F)(F)F)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H23F3N2O/c1-14-10-15(2)12-16(11-14)18(13-27)20(22(3,4)5)28-21(29)17-8-6-7-9-19(17)23(24,25)26/h6-12H,1-5H3,(H,28,29)/b20-18+ |
| InChIKey | ICHLZJPXXROYOA-CZIZESTLSA-N |
| XLogP | 6.03 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|