About N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide
N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide (PubChem CID 59073059) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide |
| PubChem CID | 59073059 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=C(/C#N)c2ccccc2)C(C)(C)C)c1C |
| InChI | InChI=1S/C22H24N2O/c1-15-10-9-13-18(16(15)2)21(25)24-20(22(3,4)5)19(14-23)17-11-7-6-8-12-17/h6-13H,1-5H3,(H,24,25)/b20-19- |
| InChIKey | JSHIVUOQOQZYAI-VXPUYCOJSA-N |
| XLogP | 5.01 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide?
The IUPAC name of N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide (CID 59073059) is N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide.
What is the SMILES notation for N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide?
The canonical SMILES for N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide is Cc1cccc(C(=O)N/C(=C(/C#N)c2ccccc2)C(C)(C)C)c1C.
What is the InChIKey of N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide?
The InChIKey is JSHIVUOQOQZYAI-VXPUYCOJSA-N. The full InChI is InChI=1S/C22H24N2O/c1-15-10-9-13-18(16(15)2)21(25)24-20(22(3,4)5)19(14-23)17-11-7-6-8-12-17/h6-13H,1-5H3,(H,24,25)/b20-19-.
What are the key properties of N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide?
N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide has a molecular weight of 332.45 g/mol, XLogP of 5.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-cyano-3,3-dimethyl-1-phenylbut-1-en-2-yl]-2,3-dimethylbenzamide is sourced from PubChem (CID 59073059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).