C33H29ClN2O2 — CID 85142522
3-chloro-N-[1-cyano-3,3-dimethyl-1-(4-phenylphenyl)but-1-en-2-yl]-4-phenylmethoxybenzamide (PubChem CID 85142522) has the molecular formula C33H29ClN2O2 and a molecular weight of 521.06 g/mol. Its IUPAC name is 3-chloro-N-[1-cyano-3,3-dimethyl-1-(4-phenylphenyl)but-1-en-2-yl]-4-phenylmethoxybenzamide.
| Compound Name | 3-chloro-N-[1-cyano-3,3-dimethyl-1-(4-phenylphenyl)but-1-en-2-yl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 85142522 |
| Molecular Formula | C33H29ClN2O2 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 3-chloro-N-[1-cyano-3,3-dimethyl-1-(4-phenylphenyl)but-1-en-2-yl]-4-phenylmethoxybenzamide |
| SMILES | CC(C)(C)C(NC(=O)c1ccc(OCc2ccccc2)c(Cl)c1)=C(C#N)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H29ClN2O2/c1-33(2,3)31(28(21-35)26-16-14-25(15-17-26)24-12-8-5-9-13-24)36-32(37)27-18-19-30(29(34)20-27)38-22-23-10-6-4-7-11-23/h4-20H,22H2,1-3H3,(H,36,37) |
| InChIKey | XPGIZJLQZDDTBL-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|