C24H28N2O3 — CID 72507662
N-[1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-3,4-dimethoxybenzamide (PubChem CID 72507662) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 72507662 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=C(C#N)c2cc(C)cc(C)c2)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C24H28N2O3/c1-15-10-16(2)12-18(11-15)19(14-25)22(24(3,4)5)26-23(27)17-8-9-20(28-6)21(13-17)29-7/h8-13H,1-7H3,(H,26,27) |
| InChIKey | OXBDNBRYFUBTHL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|