C23H24N2O3 — CID 10022411
N-[(E)-1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 10022411) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(E)-1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(E)-1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 10022411 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(E)-1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1cc(C)cc(/C(C#N)=C(\NC(=O)c2ccc3c(c2)OCO3)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-14-8-15(2)10-17(9-14)18(12-24)21(23(3,4)5)25-22(26)16-6-7-19-20(11-16)28-13-27-19/h6-11H,13H2,1-5H3,(H,25,26)/b21-18- |
| InChIKey | HAVGNPPBTYTSQB-UZYVYHOESA-N |
| XLogP | 4.74 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|