C27H23ClN2O4 — CID 85089554
N-[1-(1,3-benzodioxol-5-yl)-1-cyano-3,3-dimethylbut-1-en-2-yl]-3-(3-chlorophenoxy)benzamide (PubChem CID 85089554) has the molecular formula C27H23ClN2O4 and a molecular weight of 474.94 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-1-cyano-3,3-dimethylbut-1-en-2-yl]-3-(3-chlorophenoxy)benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-1-cyano-3,3-dimethylbut-1-en-2-yl]-3-(3-chlorophenoxy)benzamide |
|---|---|
| PubChem CID | 85089554 |
| Molecular Formula | C27H23ClN2O4 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-1-cyano-3,3-dimethylbut-1-en-2-yl]-3-(3-chlorophenoxy)benzamide |
| SMILES | CC(C)(C)C(NC(=O)c1cccc(Oc2cccc(Cl)c2)c1)=C(C#N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H23ClN2O4/c1-27(2,3)25(22(15-29)17-10-11-23-24(13-17)33-16-32-23)30-26(31)18-6-4-8-20(12-18)34-21-9-5-7-19(28)14-21/h4-14H,16H2,1-3H3,(H,30,31) |
| InChIKey | SPYDEQHWPQMFAX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|