C22H15F3N2O5 — CID 27019353
N'-[3-[3-(trifluoromethyl)phenoxy]benzoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 27019353) has the molecular formula C22H15F3N2O5 and a molecular weight of 444.37 g/mol. Its IUPAC name is N'-[3-[3-(trifluoromethyl)phenoxy]benzoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[3-[3-(trifluoromethyl)phenoxy]benzoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 27019353 |
| Molecular Formula | C22H15F3N2O5 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N'-[3-[3-(trifluoromethyl)phenoxy]benzoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2c(c1)OCO2)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H15F3N2O5/c23-22(24,25)15-4-2-6-17(11-15)32-16-5-1-3-13(9-16)20(28)26-27-21(29)14-7-8-18-19(10-14)31-12-30-18/h1-11H,12H2,(H,26,28)(H,27,29) |
| InChIKey | ZOUCIEXENHSDMO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|