C22H18F2N2O5 — CID 10002671
N-[(E)-1-(1,3-benzodioxol-5-yl)-1-cyano-3,3-dimethylbut-1-en-2-yl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide (PubChem CID 10002671) has the molecular formula C22H18F2N2O5 and a molecular weight of 428.39 g/mol. Its IUPAC name is N-[(E)-1-(1,3-benzodioxol-5-yl)-1-cyano-3,3-dimethylbut-1-en-2-yl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(E)-1-(1,3-benzodioxol-5-yl)-1-cyano-3,3-dimethylbut-1-en-2-yl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 10002671 |
| Molecular Formula | C22H18F2N2O5 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[(E)-1-(1,3-benzodioxol-5-yl)-1-cyano-3,3-dimethylbut-1-en-2-yl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)(C)/C(NC(=O)c1ccc2c(c1)OC(F)(F)O2)=C(\C#N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H18F2N2O5/c1-21(2,3)19(14(10-25)12-4-6-15-17(8-12)29-11-28-15)26-20(27)13-5-7-16-18(9-13)31-22(23,24)30-16/h4-9H,11H2,1-3H3,(H,26,27)/b19-14- |
| InChIKey | VLKKEEDRSJGNNK-RGEXLXHISA-N |
| XLogP | 4.45 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|