C12H9N3O4 — CID 21161967
N-(1,3-benzodioxole-5-carbonyl)-2-cyanoaziridine-1-carboxamide (PubChem CID 21161967) has the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. Its IUPAC name is N-(1,3-benzodioxole-5-carbonyl)-2-cyanoaziridine-1-carboxamide.
| Compound Name | N-(1,3-benzodioxole-5-carbonyl)-2-cyanoaziridine-1-carboxamide |
|---|---|
| PubChem CID | 21161967 |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-(1,3-benzodioxole-5-carbonyl)-2-cyanoaziridine-1-carboxamide |
| SMILES | N#CC1CN1C(=O)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H9N3O4/c13-4-8-5-15(8)12(17)14-11(16)7-1-2-9-10(3-7)19-6-18-9/h1-3,8H,5-6H2,(H,14,16,17) |
| InChIKey | BFQVCORRISISSW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|