C26H28F3NO3 — CID 155630954
[(E)-2-(4-tert-butylphenyl)-2-cyano-1-[2-(trifluoromethyl)phenyl]ethenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 155630954) has the molecular formula C26H28F3NO3 and a molecular weight of 459.51 g/mol. Its IUPAC name is [(E)-2-(4-tert-butylphenyl)-2-cyano-1-[2-(trifluoromethyl)phenyl]ethenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [(E)-2-(4-tert-butylphenyl)-2-cyano-1-[2-(trifluoromethyl)phenyl]ethenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155630954 |
| Molecular Formula | C26H28F3NO3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | [(E)-2-(4-tert-butylphenyl)-2-cyano-1-[2-(trifluoromethyl)phenyl]ethenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCO/C(=C(/C#N)c1ccc(C(C)(C)C)cc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H28F3NO3/c1-24(2,3)18-13-11-17(12-14-18)20(15-30)22(32-16-33-23(31)25(4,5)6)19-9-7-8-10-21(19)26(27,28)29/h7-14H,16H2,1-6H3/b22-20- |
| InChIKey | PKVSLKWVWVBDEV-XDOYNYLZSA-N |
| XLogP | 6.96 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|