C28H48O4 — CID 91729019
10-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-heptyl decanedioate (PubChem CID 91729019) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is 10-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-heptyl decanedioate.
| Compound Name | 10-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-heptyl decanedioate |
|---|---|
| PubChem CID | 91729019 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 10-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-heptyl decanedioate |
| SMILES | C=C(C)C#CC(OC(=O)CCCCCCCCC(=O)OCCCCCCC)C(C)CCC |
| InChI | InChI=1S/C28H48O4/c1-6-8-9-14-17-23-31-27(29)19-15-12-10-11-13-16-20-28(30)32-26(22-21-24(3)4)25(5)18-7-2/h25-26H,3,6-20,23H2,1-2,4-5H3 |
| InChIKey | ATFDHOVOYGVREB-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|