C24H39ClO4 — CID 91706429
1-O-(8-chlorooctyl) 5-O-(2,6-dimethylnon-1-en-3-yn-5-yl) pentanedioate (PubChem CID 91706429) has the molecular formula C24H39ClO4 and a molecular weight of 427.03 g/mol. Its IUPAC name is 1-O-(8-chlorooctyl) 5-O-(2,6-dimethylnon-1-en-3-yn-5-yl) pentanedioate.
| Compound Name | 1-O-(8-chlorooctyl) 5-O-(2,6-dimethylnon-1-en-3-yn-5-yl) pentanedioate |
|---|---|
| PubChem CID | 91706429 |
| Molecular Formula | C24H39ClO4 |
| Molecular Weight | 427.03 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 1-O-(8-chlorooctyl) 5-O-(2,6-dimethylnon-1-en-3-yn-5-yl) pentanedioate |
| SMILES | C=C(C)C#CC(OC(=O)CCCC(=O)OCCCCCCCCCl)C(C)CCC |
| InChI | InChI=1S/C24H39ClO4/c1-5-13-21(4)22(17-16-20(2)3)29-24(27)15-12-14-23(26)28-19-11-9-7-6-8-10-18-25/h21-22H,2,5-15,18-19H2,1,3-4H3 |
| InChIKey | RYVQVUMQJFFIQP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.03 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|